|
|
| | 4-Fluorophenylacetonitrile Basic information |
| Product Name: | 4-Fluorophenylacetonitrile | | Synonyms: | P-FLUOROBENZYL CYANIDE;P-FLUOROPHENYLACETONITRILE;PARA-FLUOROBENZYL CYANIDE;p-Fluorobenzyl nitrile;4-Fluorophenylacetonitrile,4-Fluorobenzyl cyanide;4-Fluorophenylacetonitrile, 99% 25GR;The fluorine benzene acetonitrile;(p-fluorophenyl)-acetonitril | | CAS: | 459-22-3 | | MF: | C8H6FN | | MW: | 135.14 | | EINECS: | 207-286-8 | | Product Categories: | Aromatic Nitriles;Nitrile;Fluorobenzene | | Mol File: | 459-22-3.mol |  |
| | 4-Fluorophenylacetonitrile Chemical Properties |
| Melting point | 86°C | | Boiling point | 119-120 °C/18 mmHg (lit.) | | density | 1.126 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5002(lit.) | | Fp | 227 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | Liquid | | color | Clear colorless to light yellow | | BRN | 1907764 | | Exposure limits | NIOSH: IDLH 25 mg/m3 | | InChI | InChI=1S/C8H6FN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 | | InChIKey | JHQBLYITVCBGTO-UHFFFAOYSA-N | | SMILES | C1(CC#N)=CC=C(F)C=C1 | | CAS DataBase Reference | 459-22-3(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Fluorophenylacetic acid nitrile(459-22-3) | | EPA Substance Registry System | Benzeneacetonitrile, 4-fluoro- (459-22-3) |
| | 4-Fluorophenylacetonitrile Usage And Synthesis |
| Chemical Properties | Clear light yellow liquid | | Uses | 4-Fluorophenylacetonitrile is used as a reagent in the synthesis of novel Daidzein analogs which exhibit anti-influenza activity in vitro. It is also used as a reagent in the synthesis of benzylbenzo[d]thiazole sulfonamides which exhibit anti-inflammatory activity. | | General Description | 4-Fluorophenylacetonitrile is starting reagent in the synthesis of 1-Alkyl-N-[2-ethyl-2-(4-fluorophenyl)butyl]piperidine-4-carboxamide derivatives. | | Biochem/physiol Actions | 4-Fluorophenylacetonitrile undergoes biotransformation to 4-Fluorophenylacetic acid by marine fungi, Aspergillus sydowii Ce19. |
| | 4-Fluorophenylacetonitrile Preparation Products And Raw materials |
|