|
|
| | 3-(Methylthio)hexyl acetate Basic information |
| | 3-(Methylthio)hexyl acetate Chemical Properties |
| Boiling point | 216 °C | | density | 0.982 | | refractive index | 1.4640 | | FEMA | 3789 | 3-(METHYLTHIO)HEXYL ACETATE | | Fp | 76 °C | | Odor | at 0.10 % in dipropylene glycol. sulfury green spicy vegetable tropical | | Odor Type | sulfurous | | biological source | synthetic | | JECFA Number | 481 | | Major Application | flavors and fragrances | | InChI | InChI=1S/C9H18O2S/c1-4-5-9(12-3)6-7-11-8(2)10/h9H,4-7H2,1-3H3 | | InChIKey | VIQXICKUKPVFRK-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)CC(SC)CCC | | LogP | 2.71 | | NIST Chemistry Reference | 3-(Methylthio)hexyl acetate(51755-85-2) |
| Hazard Codes | Xi | | Risk Statements | 38 | | Safety Statements | 26-36 | | RIDADR | UN 3334 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Skin Irrit. 2 |
| | 3-(Methylthio)hexyl acetate Usage And Synthesis |
| Occurrence | Reported found in yellow passion fruit | | Uses | flavors and fragrances | | Definition | ChEBI: (S)-3-Methylthiohexyl acetate is a carboxylic ester. | | Aroma threshold values | Aroma characteristics at 1.0%: sulfurous, green, spicy, pungent and vegetative with a tropical nuance. | | Taste threshold values | Taste characteristics: sulfurous, tropical, biting, vegetative and fruity |
| | 3-(Methylthio)hexyl acetate Preparation Products And Raw materials |
|