- Bovinic acid
-
- $0.00 / 5mg
-
2026-01-26
- CAS:2540-56-9
- Min. Order:
- Purity: 98.00%
- Supply Ability: 10g
- Bovinic acid
-
- $0.00 / 5mg
-
2026-01-26
- CAS:2540-56-9
- Min. Order:
- Purity: 98.00%
- Supply Ability: 10g
|
| | 9(Z),11(E)-OCTADECADIENOIC ACID Basic information |
| Product Name: | 9(Z),11(E)-OCTADECADIENOIC ACID | | Synonyms: | DELTA 9 CIS DELTA 11 TRANS OCTADECADIENOIC ACID;CLA 9C,11TR;CONJUGATED (9Z,11E)-LINOLEIC ACID;CONJUGATED LINOLEIC ACID (9Z,11E);BOVINIC ACID;13-OXO-9(Z),11(E)-OCTADECADIENOIC ACID;13-OXOODE;13-KETO-OCTADECA-9Z,11E-DIENOIC ACID | | CAS: | 2540-56-9 | | MF: | C18H32O2 | | MW: | 280.45 | | EINECS: | | | Product Categories: | | | Mol File: | 2540-56-9.mol |  |
| | 9(Z),11(E)-OCTADECADIENOIC ACID Chemical Properties |
| Boiling point | 381.6±11.0 °C(Predicted) | | density | 0.911±0.06 g/cm3(Predicted) | | refractive index | n20/D1.481 | | storage temp. | −20°C | | solubility | 0.15 M Tris-HCl pH 8.5: >1 mg/ml (from Oleic Acid); DMF: >100 mg/ml (from Oleic Acid); DMSO: >100 mg/ml (from Oleic Acid); Ethanol: >100 mg/ml (from Oleic Acid); PBS pH 7.2: <100 μg/ml (from Oleic Acid) | | form | Liquid | | pka | 4.78±0.10(Predicted) | | color | Colorless to light yellow | | biological source | synthetic | | Stability: | Light Sensitive | | InChI | 1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9- | | InChIKey | JBYXPOFIGCOSSB-GOJKSUSPSA-N | | SMILES | CCCCCC\C=C\C=C/CCCCCCCC(O)=O |
| | 9(Z),11(E)-OCTADECADIENOIC ACID Usage And Synthesis |
| Uses | Rumenic Acid is a trans fatty acid that may potentially reduce the risk of cancer and cardiovascular diseases.It may also prevent disease processes that lead to chronic inflammation, atherosclerosis, and diabetes. | | Definition | ChEBI: An octadeca-9,11-dienoic acid having 9-cis,11-trans-stereochemistry. | | Synthesis Reference(s) | Tetrahedron Letters, 27, p. 3745, 1986 DOI: 10.1016/S0040-4039(00)83869-1 | | IC 50 | Human Endogenous Metabolite |
| | 9(Z),11(E)-OCTADECADIENOIC ACID Preparation Products And Raw materials |
|