|
|
| | 5-BROMO-2-METHYL-1H-BENZIMIDAZOLE Basic information | | Uses |
| Product Name: | 5-BROMO-2-METHYL-1H-BENZIMIDAZOLE | | Synonyms: | 5-BROMO-2-METHYL-1H-BENZIMIDAZOLE;5-BROMO-2-METHYLBENZIMIDAZOLE;5-BROMO-2-METHYL-1H-BENZ(D)IMIDAZOLE;5-Bromo-2-methylbenzoimidazole;1H-BenziMidazole, 6-broMo-2-Methyl-;5-broMo-2-Methyl-1H-1,3-benzodiazole;5-Bromo-2-methyl-1H-benzoimidazole;5-bromo-2-methybenzimidazole | | CAS: | 1964-77-8 | | MF: | C8H7BrN2 | | MW: | 211.06 | | EINECS: | | | Product Categories: | | | Mol File: | 1964-77-8.mol |  |
| | 5-BROMO-2-METHYL-1H-BENZIMIDAZOLE Chemical Properties |
| Melting point | 214-215 °C | | Boiling point | 397.3±15.0 °C(Predicted) | | density | 1.654±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 10.50±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C8H7BrN2/c1-5-10-7-3-2-6(9)4-8(7)11-5/h2-4H,1H3,(H,10,11) | | InChIKey | FHDFUQGJYYGLHJ-UHFFFAOYSA-N | | SMILES | C1(C)NC2=CC(Br)=CC=C2N=1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-BROMO-2-METHYL-1H-BENZIMIDAZOLE Usage And Synthesis |
| Uses | 5-Bromo-2-methyl-1H-benzo[D]imidazole is a benzo[D]imidazole derivative. Benzimidazole compounds possess biological activities such as anti-HIV-1 activity, anti-tumor activity, anti-cell proliferation activity, anti-parasitic activity, anti-inflammatory activity, antioxidant activity, and anti-epileptic activity. In addition, these compounds are also used as metal ligands. Therefore, the synthesis of these compounds has attracted considerable attention from chemists. | | Synthesis | GENERAL METHOD: A mixture of 4-bromophthalimide (1.0 mmol), triethyl orthoacetate (1.2 mmol) and ZrCl4 (0.1 mmol) in 10 mL of methanol was stirred at room temperature for 3 hours. Upon completion of the reaction, the progress was monitored by TLC and the solvent was removed by concentration under reduced pressure. The crude product was purified by silica gel column chromatography with an eluent ratio of petroleum ether/ethyl acetate (4:1 to 1:1, v/v) to afford the target compound 5-bromo-2-methyl-1H-benzo[D]imidazole. | | References | [1] European Journal of Medicinal Chemistry, 2015, vol. 90, p. 241 - 250 |
| | 5-BROMO-2-METHYL-1H-BENZIMIDAZOLE Preparation Products And Raw materials |
|