| Company Name: |
Shangfluoro Gold |
| Tel: |
021-65170832 15601903708 |
| Email: |
qinba_2@163.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,1,1,3,3,3-Hexafluoroisopropyl acrylate Basic information |
| Product Name: | 1,1,1,3,3,3-Hexafluoroisopropyl acrylate | | Synonyms: | 2,2,2-Trifluoro-1-(trifluoromethyl)ethyl acrylate;2-Propenoic acid, 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester;2-propenoicacid,2,2,2-trifluoro-1-(trifluoromethyl)ethylester;ACRYLIC ACID 1,1,1,3,3,3-HEXAFLUOROISOPROPYL ESTER;1,1,1,3,3,3-HEXAFLUOROISOPROPYL ACRYLATE;2H-Hexafluoroprop-2-ylacrylate98%;1,1,1,3,3,3-Hexafluoroisopropyl Acrylate (stabilized with TBC);1,1,1,3,3,3-Hexafluoroisopropyl acrylate, stabilized with 50ppm 4-Methoxyphenol | | CAS: | 2160-89-6 | | MF: | C6H4F6O2 | | MW: | 222.09 | | EINECS: | 218-479-1 | | Product Categories: | Acrylic Monomers;C6 to C7Monomers;Carbonyl Compounds;Esters;Fluorinated AcrylicsSelf Assembly&Contact Printing;Fluorine-Containing Monomers for 157 nm UV Lithography Resist PolymersPhotonic and Optical Materials;Lithography Monomers;Low Refractive Index Monomers;Waveguide Materials;monomer | | Mol File: | 2160-89-6.mol |  |
| | 1,1,1,3,3,3-Hexafluoroisopropyl acrylate Chemical Properties |
| Boiling point | 84 °C | | density | 1.33 g/mL at 25 °C (lit.) | | vapor pressure | 1.22 psi ( 20 °C) | | refractive index | n20/D 1.319(lit.) | | Fp | 50 °F | | storage temp. | Flammables area | | form | clear liquid | | Specific Gravity | 1.330 | | color | Colorless to Almost colorless | | Water Solubility | Insoluble | | BRN | 2094742 | | InChI | InChI=1S/C6H4F6O2/c1-2-3(13)14-4(5(7,8)9)6(10,11)12/h2,4H,1H2 | | InChIKey | MNSWITGNWZSAMC-UHFFFAOYSA-N | | SMILES | C(OC(C(F)(F)F)C(F)(F)F)(=O)C=C | | CAS DataBase Reference | 2160-89-6(CAS DataBase Reference) | | NIST Chemistry Reference | Hexafluoroisopropyl acrylate(2160-89-6) | | EPA Substance Registry System | Hexafluoroisopropyl acrylate (2160-89-6) |
| Hazard Codes | Xi,N,F | | Risk Statements | 36/37/38-51/53-11 | | Safety Statements | 26-28-61-37/39-16 | | RIDADR | UN 3272 3/PG 2 | | WGK Germany | 2 | | Hazard Note | Flammable/Irritant | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29161290 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 2
Eye Irrit. 2
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,1,1,3,3,3-Hexafluoroisopropyl acrylate Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 1,1,1,3,3,3-Hexafluoroisopropyl acrylate is used in agrochemical, pharmaceutical and dyestuff field. |
| | 1,1,1,3,3,3-Hexafluoroisopropyl acrylate Preparation Products And Raw materials |
|