|
|
| | 2-(2-Chlorophenoxy)propionic acid Basic information |
| Product Name: | 2-(2-Chlorophenoxy)propionic acid | | Synonyms: | Propanoic acid, 2-(2-chlorophenoxy)-;Acide (o-chlorophenoxy)-2 propionique [French];2-(o-Chlorophenoxy)propionic acid;2-(o-chlorophenoxy)-propionicaci;2-(o-chlorophenoxy)propionicacid;Acide (o-chlorophenoxy)-2 propionique;acide(o-chlorophenoxy)-2propionique;Propionic acid, 2-(o-chlorophenoxy)- | | CAS: | 25140-86-7 | | MF: | C9H9ClO3 | | MW: | 200.62 | | EINECS: | | | Product Categories: | | | Mol File: | 25140-86-7.mol |  |
| | 2-(2-Chlorophenoxy)propionic acid Chemical Properties |
| Melting point | 110-116 °C | | Boiling point | 288.02°C (rough estimate) | | density | 1.2799 (rough estimate) | | refractive index | 1.5230 (estimate) | | storage temp. | Store at room temperature | | pka | 3.11±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C9H9ClO3/c1-6(9(11)12)13-8-5-3-2-4-7(8)10/h2-6H,1H3,(H,11,12) | | InChIKey | ZGWNXHRVUJVMCP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(OC1=CC=CC=C1Cl)C | | CAS DataBase Reference | 25140-86-7(CAS DataBase Reference) | | EPA Substance Registry System | 2-(2-Chlorophenoxy)propanoic acid (25140-86-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | RTECS | UE9350000 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29189990 | | Toxicity | rat,LD50,intraperitoneal,500mg/kg (500mg/kg),Travaux de la Societe de Pharmacie de Montpellier. Vol. 34, Pg. 121, 1974. |
| Provider | Language |
|
ACROS
| English |
| | 2-(2-Chlorophenoxy)propionic acid Usage And Synthesis |
| Chemical Properties | cream to beige crystalline powder |
| | 2-(2-Chlorophenoxy)propionic acid Preparation Products And Raw materials |
|