| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (+)-N-BENZOYLGLUTAMIC ACID Basic information |
| | (+)-N-BENZOYLGLUTAMIC ACID Chemical Properties |
| Melting point | 130-135 °C (lit.) | | Boiling point | 562.0±40.0 °C(Predicted) | | density | 1.354±0.06 g/cm3(Predicted) | | pka | 3.61±0.10(Predicted) | | Optical Rotation | [α]22/D +12°, c = 5 in H2O | | Major Application | peptide synthesis | | InChI | 1S/C12H13NO5/c14-10(15)7-6-9(12(17)18)13-11(16)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,16)(H,14,15)(H,17,18)/t9-/m1/s1 | | InChIKey | LPJXPACOXRZCCP-SECBINFHSA-N | | SMILES | OC(=O)CC[C@@H](NC(=O)c1ccccc1)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (+)-N-BENZOYLGLUTAMIC ACID Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | (+)-N-BENZOYLGLUTAMIC ACID Preparation Products And Raw materials |
|