Dihydrocytochalasin B manufacturers
- DIHYDROCYTOCHALASIN B
-
- $650.00
-
2026-02-02
- CAS:39156-67-7
- Min. Order: 1mg
- Purity: 98%
- Supply Ability: 200kg
|
| | Dihydrocytochalasin B Basic information |
| Product Name: | Dihydrocytochalasin B | | Synonyms: | CYTOCHALASIN B, DIHYDRO;Cytochalasin B, Dihydro- - CAS 39156-67-7 - Calbiochem;Dihidrocytochalasin B;7(S),20(R)-dihydroxy-16(R)-methyl-10-phenyl-24-oxa[14]cytochalasa-6(12),13(E)-diene-1,23-dione;(7S,13E,16R,20R)-7,20-Dihydroxy-16-methyl-10-phenyl-24-oxa[14]cytochalasa-6(12),13-diene-1,23-dione;(7S,13E,16R,20R)-7β,20-Dihydroxy-16-methyl-10-phenyl-24-oxa[14]cytochalasa-6(12),13-diene-1,23-dione;21,22-Dihydrocytochalalsin B;2H-Oxacyclotetradecino[2,3-d]isoindole-2,18(3H)-dione, 4,5,6,7,8,9,10,12a,13,14,15,15a,16,17-tetradecahydro-5,13-dihydroxy-9,15-dimethyl-14-methylene-16-(phenylmethyl)-, (5R,9R,11E,12aS,13S,15S,15aS,16S,18aS)- | | CAS: | 39156-67-7 | | MF: | C29H39NO5 | | MW: | 481.62 | | EINECS: | 254-324-4 | | Product Categories: | antibiotic;Actin Inhibitors and Probes;Cell Signaling and Neuroscience;Cytoskeleton and Extracellular Matrix | | Mol File: | 39156-67-7.mol |  |
| | Dihydrocytochalasin B Chemical Properties |
| Melting point | 203-205 °C | | Boiling point | 727.5±60.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 30 mg/ml; DMF:PBS (pH 7.2) (1:20): 0.05 mg/ml; DMSO: 20 mg/ml; Ethanol: 20 mg/ml | | pka | 13.65±0.70(Predicted) | | form | White solid | | color | white | | InChIKey | WIULKAASLBZREV-PEVBMUQXNA-N | | SMILES | [C@H]1(C(=C)[C@H]([C@]2([C@]3(OC(CC[C@H](O)CCC[C@@H](C)CC=C2)=O)C(=O)N[C@@H](CC2C=CC=CC=2)[C@]13[H])[H])O)C |t:18,&1:0,3,4,5,10,15,24,32,r| |
| Hazard Codes | T+,T | | Risk Statements | 26/27/28-40 | | Safety Statements | 22-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | RO0205000 | | HazardClass | 6.1(a) | | PackingGroup | I | | HS Code | 29349990 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Carc. 2 |
| | Dihydrocytochalasin B Usage And Synthesis |
| Chemical Properties | white powder | | Uses | Dihydrocytochalasin B is a cell morphology and motility and inducer. | | Biological Activity | Effect on cell motility and morphology similar to th at of cytochalasin B; does not inhibit glucose transport. |
| | Dihydrocytochalasin B Preparation Products And Raw materials |
|