| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-(4-Methoxybenzylidene)-4-methoxyaniline Basic information |
| Product Name: | N-(4-Methoxybenzylidene)-4-methoxyaniline | | Synonyms: | N-(4-Methoxybenzylidene)-4-methoxyaniline 97%;N-(p-Methoxybenzylidene)-p-anisidine;4-METHOXY-N-(4-METHOXYBENZYLIDENE)ANILINE;N-(4-METHOXYBENZYLIDENE)-4-ANISIDINE;4-Methoxy-N-(4-methoxybenzylidene)aniline, N-(4-Methoxybenzylidene)-4-anisidine;(4-methoxybenzylidene)-(4-methoxyphenyl)amine;N,1-bis(4-methoxyphenyl)methanimine;(E)-4-Methoxy-N-(4-Methoxybenzylidene)aniline | | CAS: | 1749-08-2 | | MF: | C15H15NO2 | | MW: | 241.29 | | EINECS: | | | Product Categories: | | | Mol File: | 1749-08-2.mol |  |
| | N-(4-Methoxybenzylidene)-4-methoxyaniline Chemical Properties |
| Melting point | 146-150 °C(lit.) | | Boiling point | 389.5±27.0 °C(Predicted) | | density | 1.03±0.1 g/cm3(Predicted) | | form | solid | | pka | 4.51±0.50(Predicted) | | InChI | 1S/C15H15NO2/c1-17-14-7-3-12(4-8-14)11-16-13-5-9-15(18-2)10-6-13/h3-11H,1-2H3/b16-11+ | | InChIKey | ZDOHZYPZEUJYKN-LFIBNONCSA-N | | SMILES | COc1ccc(cc1)\C=N\c2ccc(OC)cc2 |
| Hazard Codes | Xi | | Risk Statements | 37/38-41-43 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | N-(4-Methoxybenzylidene)-4-methoxyaniline Usage And Synthesis |
| | N-(4-Methoxybenzylidene)-4-methoxyaniline Preparation Products And Raw materials |
|