|
|
| | N-(4-Methoxybenzylidene)-4-acetoxyaniline Basic information |
| | N-(4-Methoxybenzylidene)-4-acetoxyaniline Chemical Properties |
| Boiling point | 418.2±30.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | storage temp. | 0-6°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.53±0.50(Predicted) | | color | White to Light red to Green | | InChI | InChI=1S/C16H15NO3/c1-12(18)20-16-9-5-14(6-10-16)17-11-13-3-7-15(19-2)8-4-13/h3-11H,1-2H3/b17-11+ | | InChIKey | HOYWVKUPOCFKOT-GZTJUZNOSA-N | | SMILES | C1(OC(=O)C)=CC=C(/N=C/C2=CC=C(OC)C=C2)C=C1 | | EPA Substance Registry System | Phenol, 4-[(E)-[(4-methoxyphenyl)methylene]amino]-, acetate (ester) (10484-13-6) |
| Safety Statements | 24/25 | | TSCA | TSCA listed | | HS Code | 2925.29.9000 |
| Provider | Language |
|
ACROS
| English |
| | N-(4-Methoxybenzylidene)-4-acetoxyaniline Usage And Synthesis |
| | N-(4-Methoxybenzylidene)-4-acetoxyaniline Preparation Products And Raw materials |
|