| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | DI(N-SUCCINIMIDYL) OXALATE Basic information |
| Product Name: | DI(N-SUCCINIMIDYL) OXALATE | | Synonyms: | DI(N-SUCCINIMIDYL) OXALATE;DISUCCINIMIDYL OXALATE;oxalic acid bis(N-hydroxysuccinimide)*ester;n,n'-disuccinimidyl oxalate;Bis-(N-succinimidyl)-oxalate;N,Nμ-Disuccinimidyl oxalate, Di(N-succinimidyl) oxalate, DSO;N,Nμ-Disuccinimidyl oxalate, DSO;N,N'-DISUCCINIMIDO OXALATE | | CAS: | 57296-03-4 | | MF: | C10H8N2O8 | | MW: | 284.18 | | EINECS: | | | Product Categories: | | | Mol File: | 57296-03-4.mol |  |
| | DI(N-SUCCINIMIDYL) OXALATE Chemical Properties |
| Melting point | 239 °C (dec.)(lit.) | | Boiling point | 427.9±28.0 °C(Predicted) | | density | 1.72±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | BRN | 4562450 | | Major Application | peptide synthesis | | InChI | 1S/C10H8N2O8/c13-5-1-2-6(14)11(5)19-9(17)10(18)20-12-7(15)3-4-8(12)16/h1-4H2 | | InChIKey | OMAHFYGHUQSIEF-UHFFFAOYSA-N | | SMILES | O=C1CCC(=O)N1OC(=O)C(=O)ON2C(=O)CCC2=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | DI(N-SUCCINIMIDYL) OXALATE Usage And Synthesis |
| | DI(N-SUCCINIMIDYL) OXALATE Preparation Products And Raw materials |
|