(S,R,S)-AHPC-amido-C5-acid manufacturers
|
| | (S,R,S)-AHPC-amido-C5-acid Basic information |
| Product Name: | (S,R,S)-AHPC-amido-C5-acid | | Synonyms: | (S,R,S)-AHPC-amido-C5-acid;7-(((S)-1-((2S,4R)-4-hydroxy-2-((4-(4-methylthiazol-5-yl)benzyl)carbamoyl)pyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl)amino)-7-oxoheptanoic acid;L-Prolinamide, N-(6-carboxy-1-oxohexyl)-3-methyl-L-valyl-4-hydroxy-N-[[4-(4-methyl-5-thiazolyl)phenyl]methyl]-, (4R)-;7-[[(S)-1-[(2S,4R)-4-Hydroxy-2-[[4-(4-methyl-5-thiazolyl)benzyl]carbamoyl]-1-pyrrolidinyl]-3,3-dimethyl-1-oxo-2-butyl]amino]-7-oxoheptanoic Acid;(S,R,S)-AHPC-CO-C5-acid, (S,R,S)-AHPC-amido-C5-acid, 6-{[(2S)-1-[(2S,4R)-4-hydroxy-2-({[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl}carbamoyl)pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl}hexanoic acid, L-Prolinamide, N-(6-carboxy-1-oxohexyl)-3-methyl-L-valyl-4-hydroxy-N-[[4-(4-methyl-5-thiazolyl)phenyl],methyl]-, (4R)-;VH032-C4-COOH;6-{[(2S)-1-[(2S,4R)-4-hydroxy-2-({[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl}carbamoyl)pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl}hexanoic acid;VH 032 amide-alkyl C5-acid | | CAS: | 2162120-87-6 | | MF: | C29H40N4O6S | | MW: | 572.72 | | EINECS: | | | Product Categories: | | | Mol File: | 2162120-87-6.mol |  |
| | (S,R,S)-AHPC-amido-C5-acid Chemical Properties |
| Boiling point | 881.3±65.0 °C(Predicted) | | density | 1.257±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Solid | | pka | 4.75±0.10(Predicted) | | color | White to yellow | | InChIKey | LYAMSRXTXVKKIC-TVZXLZGTSA-N | | SMILES | C([C@@H](NC(CCCCCC(O)=O)=O)C(C)(C)C)(=O)N1[C@H](C(NCC2=CC=C(C=C2)C3=C(C)N=CS3)=O)C[C@@H](O)C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (S,R,S)-AHPC-amido-C5-acid Usage And Synthesis |
| Uses | (S,R,S)-AHPC-amido-C5-acid incorporates a VHL ligand for the E3 ubiquitin ligase, and a PROTAC linker. (S,R,S)-AHPC-amido-C5-acid can be used to design XY028-133 (HY-129180)[1]. | | Biological Activity | (S,R,S)-AHPC-amido-C5-acid incorporates a VHL ligand for the E3 ubiquitin ligase, and a PROTAC linker. (S,R,S)-AHPC-amido-C5-acid can be used to design XY028-133 [1]. | | IC 50 | VHL | | storage | Store at -20°C | | References | [1]. Jian Jin, et al. Compositions and methods for treating cdk4/6-mediated cancer. WO2018106870A1. |
| | (S,R,S)-AHPC-amido-C5-acid Preparation Products And Raw materials |
|