|
|
| | 1-Bromo-3-trimethylsilylbenzene Basic information |
| Product Name: | 1-Bromo-3-trimethylsilylbenzene | | Synonyms: | (3-Bromophenyl)trimethylsilane;1-Bromo-3-(trimethylsilyl)benzene 97%;1-Bromo-3-(trimethylsilyl)benzene >Benzene, 1-bromo-3-(trimethylsilyl)-;(3-bromophenyl)trimethylsiliconalkane;1-Bromo-3-trimethylsilylbenzene | | CAS: | 17878-47-6 | | MF: | C9H13BrSi | | MW: | 229.19 | | EINECS: | | | Product Categories: | | | Mol File: | 17878-47-6.mol |  |
| | 1-Bromo-3-trimethylsilylbenzene Chemical Properties |
| Boiling point | 50°C/0.5mmHg(lit.) | | density | 1.230 g/mL at 25 °C | | refractive index | n20/D1.532 | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C9H13BrSi/c1-11(2,3)9-6-4-5-8(10)7-9/h4-7H,1-3H3 | | InChIKey | JXQZFRPARQBDKV-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC([Si](C)(C)C)=C1 |
| Risk Statements | 53 | | WGK Germany | 3 | | HS Code | 2931.90.6000 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 1-Bromo-3-trimethylsilylbenzene Usage And Synthesis |
| | 1-Bromo-3-trimethylsilylbenzene Preparation Products And Raw materials |
|