| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
N-(4-Chlorophenyl)-2-[(pyridin-4-ylmethyl)amino]benzamide manufacturers
|
| | N-(4-Chlorophenyl)-2-[(pyridin-4-ylmethyl)amino]benzamide Basic information |
| | N-(4-Chlorophenyl)-2-[(pyridin-4-ylmethyl)amino]benzamide Chemical Properties |
| Boiling point | 463.6±40.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF: 50 mg/ml; DMSO: 50 mg/ml; DMSO:PBS(pH 7.2) (1:3): 0.25 mg/ml; Ethanol: 25 mg/ml | | form | A crystalline solid | | pka | 12.62±0.70(Predicted) | | color | White to off-white | | InChI | 1S/C19H16ClN3O/c20-15-5-7-16(8-6-15)23-19(24)17-3-1-2-4-18(17)22-13-14-9-11-21-12-10-14/h1-12,22H,13H2,(H,23,24) | | InChIKey | GGPZCOONYBPZEW-UHFFFAOYSA-N | | SMILES | Clc1ccc(cc1)NC(=O)c2c(cccc2)NCc3ccncc3 |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | N-(4-Chlorophenyl)-2-[(pyridin-4-ylmethyl)amino]benzamide Usage And Synthesis |
| Uses | VEGFR Tyrosine Kinase Inhibitor II is an agent that potently inhibits kinase activities of KDR, Flt-1 and c-Kit. | | Biological Activity | Cell permeable: yes', 'Primary Target Kinase activities of KDR, Flt-1 and c-Kit', 'Product competes with ATP.', 'Reversible: yes', 'Target IC50: 20 nM, 180 nM and 240 nM against kinase activities of KDR, Flt-1 and c-Kit, respectively | | IC 50 | KDR: 0.02 μM (IC50); Flt-1: 0.18 μM (IC50); EGFR: 0.24 μM (IC50) |
| | N-(4-Chlorophenyl)-2-[(pyridin-4-ylmethyl)amino]benzamide Preparation Products And Raw materials |
|