| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4,4′-Diaminodiphenylamine sulfate salt Basic information |
| | 4,4′-Diaminodiphenylamine sulfate salt Chemical Properties |
| Melting point | 300 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO | | form | Solid | | color | Off-White | | InChI | InChI=1S/C12H13N3.H2O4S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;1-5(2,3)4/h1-8,15H,13-14H2;(H2,1,2,3,4) | | InChIKey | OOZQLPDAELLDNY-UHFFFAOYSA-N | | SMILES | S(O)(=O)(=O)O.C1(C=CC(N)=CC=1)NC1=CC=C(N)C=C1 | | CAS DataBase Reference | 53760-27-3(CAS DataBase Reference) |
| RIDADR | UN 2811 6.1/PG 3 | | HazardClass | 6.1 | | HS Code | 2921199990 |
| | 4,4′-Diaminodiphenylamine sulfate salt Usage And Synthesis |
| Chemical Properties | DARK BLUE VERY FINE CRYSTALLINE POWDER | | Uses | 4,4'-Diaminodiphenylamine Sulfate Hydrate is a compound used in anti-corrosive coating material for the prevention of corrosion in metals. | | Preparation | Bis(4-nitrophenyl)amine reduction. | | Properties and Applications | needle crystal, melting point 158 ℃, commodities for sulfate. Mainly used for cotton and glue dyeing and printing. Dyeing cotton, and the color of phenol AS, AS-D coupled dye blue-black, coupling speed medium, coupled ability is weak, coupled pH of seven to 8.2. |
| | 4,4′-Diaminodiphenylamine sulfate salt Preparation Products And Raw materials |
|