|
|
| | L-Citrulline DL-Malate 2:1 Basic information |
| | L-Citrulline DL-Malate 2:1 Chemical Properties |
| form | solid | | InChI | InChI=1/C6H13N3O3.C4H6O5/c7-4(5(10)11)2-1-3-9-6(8)12;5-2(4(8)9)1-3(6)7/h4H,1-3,7H2,(H,10,11)(H3,8,9,12);2,5H,1H2,(H,6,7)(H,8,9)/t4-;/s3 | | InChIKey | DROVUXYZTXCEBX-NDILARRWNA-N | | SMILES | C(O)(=O)[C@H](CCCNC(N)=O)N.C(O)(=O)C(CC(O)=O)O |&1:3,r| | | LogP | -1.526 (est) |
| | L-Citrulline DL-Malate 2:1 Usage And Synthesis |
| Description |
L-Citrulline DL-Malate, or simply citrulline malate, combines l-citrulline a and malic acid. Malate, also known as malic acid, is a compound that occurs naturally in many fruits. It is mostly used as a food additive or preservative. The combination of Citrulline and malic acid has been shown to promote better absorption and increased bioavailability. However, some studies have shown that malic acid, on its own, has the potential to support pain management and promote increased physical energy. Many skincare products also include malic acid for its potential exfoliating properties.
|
| | L-Citrulline DL-Malate 2:1 Preparation Products And Raw materials |
|