- 4-Maleimidophenol
-
- $50.00 / 1KG
-
2025-09-25
- CAS:7300-91-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 4-Maleimidophenol
-
- $1.00 / 1KG
-
2019-12-27
- CAS:7300-91-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | 4-Maleimidophenol Basic information |
| Product Name: | 4-Maleimidophenol | | Synonyms: | 1-(4-HYDROXYPHENYL)-2,5-DIOXO-PYRROLE;4-Maleimidophenol;N-(4-HYDROXYPHENYL) MALEIMIDE;1-(4-Hydroxyphenyl)-3-pyrroline-2,5-dione;4-(Maleimide-N-yl)phenol;N-(4-hydroxylphenyl)maleimide;1-(4-hydroxyphenyl)-1H-pyrrole-2,5-dione;1-(4-Hydroxyphenyl)-pyrrole-2,5-dione | | CAS: | 7300-91-6 | | MF: | C10H7NO3 | | MW: | 189.17 | | EINECS: | 230-750-6 | | Product Categories: | Miscellaneous | | Mol File: | 7300-91-6.mol |  |
| | 4-Maleimidophenol Chemical Properties |
| Melting point | 154-155 °C | | Boiling point | 397.0±25.0 °C(Predicted) | | density | 1.470±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.30±0.26(Predicted) | | color | Yellow to Dark Orange | | InChI | InChI=1S/C10H7NO3/c12-8-3-1-7(2-4-8)11-9(13)5-6-10(11)14/h1-6,12H | | InChIKey | BLLFPKZTBLMEFG-UHFFFAOYSA-N | | SMILES | N1(C2=CC=C(O)C=C2)C(=O)C=CC1=O |
| | 4-Maleimidophenol Usage And Synthesis |
| Uses | N-(4-Hydroxyphenyl)maleimide |
| | 4-Maleimidophenol Preparation Products And Raw materials |
|