|
|
| | N,N'-1,3-Phenylene bismaleimide Basic information |
| Product Name: | N,N'-1,3-Phenylene bismaleimide | | Synonyms: | VANAX MBM;1,1’-(1,3-phenylene)bis-1h-pyrrole-5-dione;hva-2curingagent;m-phdm;n,n’-(m-phenylene)bismaleimide;n,n’-(m-phenylene)di-maleimid;N,N'-M-PHENYLENEDIMALEIMIDE;N,N'-1,3-BISMALEIMIDOBENZENE | | CAS: | 3006-93-7 | | MF: | C14H8N2O4 | | MW: | 268.22 | | EINECS: | 221-112-8 | | Product Categories: | Homobifunctional Crosslinker;Acrylic Monomers;Maleimide;Monomers;N-Substituted Maleimides;N-Substituted Maleimides, Succinimides & Phthalimides;rubber additive;rubber auxiliary;Curing Agent | | Mol File: | 3006-93-7.mol |  |
| | N,N'-1,3-Phenylene bismaleimide Chemical Properties |
| Melting point | 198-201 °C(lit.) | | Boiling point | 411.39°C (rough estimate) | | density | 1.3140 (rough estimate) | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.5910 (estimate) | | Fp | >208℃ | | storage temp. | Sealed in dry,Room Temperature | | pka | -1.67±0.20(Predicted) | | form | powder to crystal | | color | Light yellow to Brown to Dark green | | Water Solubility | negligible soluble | | InChI | InChI=1S/C14H8N2O4/c17-11-4-5-12(18)15(11)9-2-1-3-10(8-9)16-13(19)6-7-14(16)20/h1-8H | | InChIKey | IPJGAEWUPXWFPL-UHFFFAOYSA-N | | SMILES | C1(N2C(=O)C=CC2=O)=CC=CC(N2C(=O)C=CC2=O)=C1 | | LogP | 0.67 at 24℃ | | CAS DataBase Reference | 3006-93-7(CAS DataBase Reference) | | EPA Substance Registry System | 1H-Pyrrole-2,5-dione, 1,1'-(1,3-phenylene)bis- (3006-93-7) |
| Hazard Codes | T,Xi,T+ | | Risk Statements | 23/24/25-36/37/38-26-22 | | Safety Statements | 27-28-36/37/39-45-38-28A | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | ON6125000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 38220090 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Inhalation
Acute Tox. 4 Oral | | Toxicity | LD50 oral in rat: 1370mg/kg |
| | N,N'-1,3-Phenylene bismaleimide Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | rubber vulcanizing agent; rubber crosslinkimg agent | | Uses | N,N'-1,3-Phenylene bismaleimide and sulfur coordination to prevent reversion to improve the heat resistance, reduce heat, anti-aging, improve adhesion of the rubber and tire cord and vulcanized rubber modulus.PDM is a non-sulfur vulcanizing agents solve copper wire and copper electrical contacts because of sulfur vulcanizing agent to generate black copper sulfide pollution problems. | | Flammability and Explosibility | Not classified |
| | N,N'-1,3-Phenylene bismaleimide Preparation Products And Raw materials |
|