| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Sorbinil
CAS:68367-52-2
Purity:>=98% (HPLC) Package:25MG Remarks:S7701-25MG
|
| Company Name: |
Shanghai Synchem Pharma Co., ltd
|
| Tel: |
21-619849051-1 18521059765 |
| Email: |
synchempharma@aliyun.com |
| Products Intro: |
Product Name:sorbinil
CAS:68367-52-2
Purity:95%+ Package:50g;1kg;25kg or as request
|
- Sorbinil
-
- $106.00
-
2026-08-08
- CAS:68367-52-2
- Purity: 99.89%
- Supply Ability: 10g
|
| | Sorbinil Basic information |
| Product Name: | Sorbinil | | Synonyms: | Spiro[4H-1-benzopyran-4,4'-imidazolidine]-2',5'-dione, 6-fluoro-2,3-dihydro-, (4S)-;(4S)-6'-Fluoro-2',3'-dihydrospiro[imidazolidine-4,4'-[4H][1]benzopyran]-2,5-dione;(4S)-6-Fluorospiro[2H-1-benzopyran-4(3H),4'-imidazolidine]-2',5'-dione;(S)-6-Fluoro-2,3-dihydrospiro[4H-1-benzopyran-4,4'-imidazolidine]-2',5'-dione;CP-45634;(4S)-6-Fluoro-2,3-dihydrospiro[4H-1-benzopyran-4,4'-imidazolidine]-2',5'-dione;(S)-(+)-Sorbinil;(+)-(4S)-6-Fluorospiro[chroman-4,4′-imidazolidine]-2′,5′-dione | | CAS: | 68367-52-2 | | MF: | C11H9FN2O3 | | MW: | 236.2 | | EINECS: | | | Product Categories: | | | Mol File: | 68367-52-2.mol |  |
| | Sorbinil Chemical Properties |
| Melting point | 241-243° | | alpha | D25 +54.0° (c = 1 in methanol) | | density | 1.52 | | storage temp. | 2-8°C | | solubility | DMSO: ≥20mg/mL | | form | powder | | pka | 8.91±0.20(Predicted) | | color | white to off-white | | Optical Rotation | [α]/D +50 to +60°, c = 1 in methanol | | InChI | 1S/C11H9FN2O3/c12-6-1-2-8-7(5-6)11(3-4-17-8)9(15)13-10(16)14-11/h1-2,5H,3-4H2,(H2,13,14,15,16)/t11-/m0/s1 | | InChIKey | LXANPKRCLVQAOG-NSHDSACASA-N | | SMILES | Fc1ccc2OCC[C@]3(NC(=O)NC3=O)c2c1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Sorbinil Usage And Synthesis |
| Uses | Enzyme inhibitor (aldose reductase). | | Uses | Sorbinil has been used as an aldose reductase inhibitor in diabetic rats as a positive control group. | | Definition | ChEBI: An azaspiro compound having a monofluoro-substituted chromane skeleton spiro-linked to an imidazolidinedione ring. | | Biochem/physiol Actions | Sorbinil decreases the level of sorbitol in red blood cells and increases the velocity of nerve conduction. It maintains the myo-inositol content in the nerve and prevents the reduction of sodium-potassium ATPase activity. This action is beneficial in providing symptomatic relief in patients with diabetic neuropathy. | | in vivo | Sorbinil (10 mg/kg; ip; single dose ) attenuates LPS-induced uveitis in mice eyes[2].
|
| | Sorbinil Preparation Products And Raw materials |
|