| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Dicyclohexyl(9-benzylfluoren-9-yl)phosphoniuM tetrafluoroborate, Min. 97% [cataCXiuM? FBn] CAS:937378-18-2 Package:2g,500Mg
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(9-Benzyl-9-fluorenyl)dicyclohexylphosphoniuM tetrafluoroborate CAS:937378-18-2 Purity:97% Package:1G,5G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:(9-Benzyl-9-fluorenyl)dicyclohexylphosphonium tetrafluoroborate 97% CAS:937378-18-2 Remarks:RA10470277
|
|
| | Dicyclohexyl(9-benzylfluoren-9-yl)phosphoniumtetrafluoroborate,min.97%[cataCXiumFBn] Basic information |
| | Dicyclohexyl(9-benzylfluoren-9-yl)phosphoniumtetrafluoroborate,min.97%[cataCXiumFBn] Chemical Properties |
| form | Powder | | color | white | | Sensitive | air sensitive | | InChIKey | TXCRCYKOFGNXQO-UHFFFAOYSA-O | | SMILES | F[B-](F)(F)F.C1CCC(CC1)[PH+](C2CCCCC2)C4(Cc3ccccc3)c5ccccc5-c6ccccc46 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Dicyclohexyl(9-benzylfluoren-9-yl)phosphoniumtetrafluoroborate,min.97%[cataCXiumFBn] Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Catalyst for Sonogashira, Suzuki, and Buchwald-Hartwig coupling reactions | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| | Dicyclohexyl(9-benzylfluoren-9-yl)phosphoniumtetrafluoroborate,min.97%[cataCXiumFBn] Preparation Products And Raw materials |
|