|
|
| | 5-NORBORNENE-2,2-DIMETHANOL Basic information |
| | 5-NORBORNENE-2,2-DIMETHANOL Chemical Properties |
| Melting point | 111-113 °C (lit.) | | Boiling point | 252.9±15.0 °C(Predicted) | | density | 1.150±0.06 g/cm3(Predicted) | | solubility | very faint turbidity in Methanol | | form | powder to crystal | | pka | 14.62±0.10(Predicted) | | color | White to Light yellow | | InChI | 1S/C9H14O2/c10-5-9(6-11)4-7-1-2-8(9)3-7/h1-2,7-8,10-11H,3-6H2/t7-,8+/m0/s1 | | InChIKey | DSHXMENPUICESR-JGVFFNPUSA-N | | SMILES | OCC1(CO)C[C@@H]2C[C@H]1C=C2 | | EPA Substance Registry System | Bicyclo[2.2.1]hept-5-ene-2,2-dimethanol (6707-12-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2906190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-NORBORNENE-2,2-DIMETHANOL Usage And Synthesis |
| | 5-NORBORNENE-2,2-DIMETHANOL Preparation Products And Raw materials |
|