|
|
| | NSC4912 Basic information |
| Product Name: | NSC4912 | | Synonyms: | 1-(4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-4-amine;NSC4912;1H-Pyrazolo[3,4-d]pyrimidin-4-amine, 1-(4-nitrophenyl)-;1-(4-Nitrophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine | | CAS: | 65973-73-1 | | MF: | C11H8N6O2 | | MW: | 256.22 | | EINECS: | | | Product Categories: | | | Mol File: | 65973-73-1.mol |  |
| | NSC4912 Chemical Properties |
| Melting point | >250° | | form | solid | | InChI | 1S/C11H8N6O2/c12-10-9-5-15-16(11(9)14-6-13-10)7-1-3-8(4-2-7)17(18)19/h1-6H,(H2,12,13,14) | | InChIKey | NFVAFEQWWNNKLX-UHFFFAOYSA-N | | SMILES | Nc1ncnc2n(ncc12)-c3ccc(cc3)[N+]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | NSC4912 Usage And Synthesis |
| | NSC4912 Preparation Products And Raw materials |
|