| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | CAPTAN D6 Basic information |
| Product Name: | CAPTAN D6 | | Synonyms: | 3a,4,7,7a-Tetrahydro-2-[(trichloroMethyl)thio]-1H-isoindole-1,3(2H)-dione-d6;N-[(TrichloroMethyl)thio]-4-c
yclohexene-1,2-dicarboxiMide-d6;N-[(TrichloroMethyl)thio]tetrahydrophthaliMide-d6;N-TrichloroMethylthio-3a,4,7,7a-tetrahydro-
phthaliMi;CAPTAN D6;D6-Captan;[2H6]-Captan;Captan-3,3,4,5,6,6-d? | | CAS: | 1330190-00-5 | | MF: | C9H2Cl3D6NO2S | | MW: | 306.63 | | EINECS: | | | Product Categories: | Agro-Products;Isotope Labelled Compounds;Sulfur & Selenium Compounds | | Mol File: | Mol File |  |
| | CAPTAN D6 Chemical Properties |
| Boiling point | 314.163±52.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.630±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly, Sonicated) | | form | Solid | | pka | -2.683±0.20(predicted) | | color | White to Pale Yellow | | InChI | 1S/C9H8Cl3NO2S/c10-9(11,12)16-13-7(14)5-3-1-2-4-6(5)8(13)15/h1-2,5-6H,3-4H2/i1D,2D,3D2,4D2 | | InChIKey | LDVVMCZRFWMZSG-TZCZJOIZSA-N | | SMILES | [2H]C1([2H])C2C(C(N(SC(Cl)(Cl)Cl)C2=O)=O)C([2H])([2H])C([2H])=C1[2H] |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Dam. 1 Skin Sens. 1 |
| | CAPTAN D6 Usage And Synthesis |
| Uses | (Captan D6) Labelled Captan (C175725). Fungicide, often added to pesticide mixtures used to control diseases among fruits, vegetables. |
| | CAPTAN D6 Preparation Products And Raw materials |
|