N-(Heptan-4-yl)benzo(d)(1,3)dioxole-5-carboxamide manufacturers
|
| | N-(Heptan-4-yl)benzo(d)(1,3)dioxole-5-carboxamide Basic information |
| | N-(Heptan-4-yl)benzo(d)(1,3)dioxole-5-carboxamide Chemical Properties |
| Boiling point | 379.0±31.0 °C(Predicted) | | density | 1.095±0.06 g/cm3(Predicted) | | FEMA | 4232 | N-(HEPTAN-4-YL)BENZO[D][1,3]DIOXOLE-5-CARBOXAMIDE | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 14.26±0.20(Predicted) | | Odor | savory meaty | | JECFA Number | 1767 | | InChI | InChI=1S/C15H21NO3/c1-3-5-12(6-4-2)16-15(17)11-7-8-13-14(9-11)19-10-18-13/h7-9,12H,3-6,10H2,1-2H3,(H,16,17) | | InChIKey | YOBNUUGTIXQSPD-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(C(NC(CCC)CCC)=O)C=C2OC1 | | LogP | 3.28 |
| | N-(Heptan-4-yl)benzo(d)(1,3)dioxole-5-carboxamide Usage And Synthesis |
| Chemical Properties | Off-white powder; savory, meat-like aroma. | | Definition | ChEBI: N-(Heptan-4-yl)benzo[d][1,3]dioxole-5-carboxamide is a member of benzodioxoles. |
| | N-(Heptan-4-yl)benzo(d)(1,3)dioxole-5-carboxamide Preparation Products And Raw materials |
|