1,5-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester manufacturers
|
| | 1,5-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester Basic information |
| Product Name: | 1,5-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester | | Synonyms: | 1,5-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester;1,5-DiMethyl-1H-pyrazol-4-ylboronic acid,pinacol ester;1H-Pyrazole, 1,5-diMethyl-4-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-;1,5-diMethyl-4-(tetraMethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;1,5-Dimethyl-1H-pyrazole-4-boronic acid, pinacol ester 98%;1,5-Dimethylpyrazole-4-boronic Acid Pinacol Ester;1,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;2-(1,5-Dimethyl-1H-pyrazol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | CAS: | 1036991-40-8 | | MF: | C11H19BN2O2 | | MW: | 222.09 | | EINECS: | | | Product Categories: | | | Mol File: | 1036991-40-8.mol |  |
| | 1,5-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester Chemical Properties |
| Melting point | 87 °C | | Boiling point | 322.3±30.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 2.66±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | 1S/C11H19BN2O2/c1-8-9(7-13-14(8)6)12-15-10(2,3)11(4,5)16-12/h7H,1-6H3 | | InChIKey | ZLIQCQOFVHSHPX-UHFFFAOYSA-N | | SMILES | B2(OC(C(O2)(C)C)(C)C)c1c([n](nc1)C)C |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2933199090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1,5-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester Usage And Synthesis |
| Uses | 1,5-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester |
| | 1,5-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester Preparation Products And Raw materials |
|