|
|
| | 1,3-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester Basic information |
| Product Name: | 1,3-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester | | Synonyms: | 1,3-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester;1,3-DiMethyl-1H-pyrazol-4-ylboronic acid,pinacol ester;1,3-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 2-(1,3-Dimethyl-1H-pyrazol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;1,3-DiMethylpyrazole-4-boronic acid pinacol ester;1,3-DiMethyl-1H-pyrazole-4-boronic acid,pinacol este;1,3-dimethyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;1,3-Dimethylpyrazole-4-boronic acid pinacol ester 97%;1H-Pyrazole, 1,3-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | | CAS: | 1046832-21-6 | | MF: | C11H19BN2O2 | | MW: | 222.09 | | EINECS: | | | Product Categories: | | | Mol File: | 1046832-21-6.mol |  |
| | 1,3-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester Chemical Properties |
| Melting point | 73.0 to 77.0 °C | | Boiling point | 322.3±30.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder to crystal | | pka | 2.56±0.10(Predicted) | | color | White to Orange to Green | | InChI | 1S/C11H19BN2O2/c1-8-9(7-14(6)13-8)12-15-10(2,3)11(4,5)16-12/h7H,1-6H3 | | InChIKey | FBNAMBTYMSWTIB-UHFFFAOYSA-N | | SMILES | Cc1nn(C)cc1B2OC(C)(C)C(C)(C)O2 | | CAS DataBase Reference | 1046832-21-6 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,3-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester Usage And Synthesis |
| Uses | 1,3-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester | | Synthesis | 4-Bromo-1,3-dimethyl-1H-pyrazole (5.00 g, 28.60 mmol) and pinacol ester of bisboronic acid (8.71 g, 34.32 mmol) were reacted in anhydrous 1,4-dioxane (100.0 mL). Potassium acetate (5.63 g, 57.41 mmol) and Pd(dppf)Cl2-CH2Cl2 (2.38 g, 2.86 mmol) were added to the reaction system. The reaction mixture was displaced three times with nitrogen to remove air, followed by warming to 100 °C and stirring the reaction overnight. After completion of the reaction, the reaction mixture was concentrated under reduced pressure. The concentrated residue was diluted with water (30 mL) and extracted with ethyl acetate (50 mL x 3). The organic layers were combined and dried over anhydrous sodium sulfate. The obtained residue was purified by silica gel column chromatography (eluent: ethyl acetate/petroleum ether) to afford the target product 1,3-dimethylpyrazole-4-boronic acid pinacol ester as a brown viscous liquid (3.80 g, 60% yield). | | References | [1] Patent: WO2015/89327, 2015, A1. Location in patent: Paragraph 0297
[2] Patent: CN108570048, 2018, A. Location in patent: Paragraph 0590; 0592-0593
[3] Patent: WO2018/169700, 2018, A1. Location in patent: Page/Page column 00343
[4] Patent: US2013/123281, 2013, A1. Location in patent: Paragraph 0127; 0128 |
| | 1,3-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester Preparation Products And Raw materials |
| Raw materials | AKOS B019512-->Potassium Acetate-->1,3-Dimethylpyrazole-->2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane-->1,4-Dioxane-->1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloride dichloromethane complex-->Bis(pinacolato)diboron | | Preparation Products | 1,5-Dimethyl-1H-pyrazole-4-boronic acid,pinacol ester |
|