5-Fluorouracil-15N2 manufacturers
- 5-Fluorouracil-15N2
-
- $1.00
-
2020-05-15
- CAS: 68941-95-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | 5-Fluorouracil-15N2 Basic information |
| | 5-Fluorouracil-15N2 Chemical Properties |
| Melting point | 282-286 °C(lit.) | | density | 1.538±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | solubility | DMSO (Slightly), Methanol (Very Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9)/i6+1,7+1 | | InChIKey | GHASVSINZRGABV-AKZCFXPHSA-N | | SMILES | FC1=C[15NH]C(=O)[15NH]C1=O | | CAS Number Unlabeled | 51-21-8 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Fluorouracil-15N2 Usage And Synthesis |
| Uses | 5-Fluorouracil-15N2 (CAS# 68941-95-7) is a useful isotopically labeled research compound. This compound can be used for isotopic analysis by gas chromatography-mass spectroscopy for various pyrimidine metabolites and antimetabolites. |
| | 5-Fluorouracil-15N2 Preparation Products And Raw materials |
|