|
|
| | 6-CHLORO-IMIDAZO[1,2-B]PYRIDAZIN-3-AMINE Basic information |
| Product Name: | 6-CHLORO-IMIDAZO[1,2-B]PYRIDAZIN-3-AMINE | | Synonyms: | 6-CHLORO-IMIDAZO[1,2-B]PYRIDAZIN-3-AMINE;3-AMINO-6-CHLOROIMIDAZO[1,2-B]PYRIDAZINE;6-Chloroimidazo[1,2-b]pyridazin-3-amine,>97%;6-CHLORO-IMIDAZO[1,2-B]PYRIDAZIN-3-AMINE ISO 9001:2015 REACH | | CAS: | 166176-45-0 | | MF: | C6H5ClN4 | | MW: | 168.58 | | EINECS: | 200-001-2 | | Product Categories: | | | Mol File: | 166176-45-0.mol | ![6-CHLORO-IMIDAZO[1,2-B]PYRIDAZIN-3-AMINE Structure](CAS/GIF/166176-45-0.gif) |
| | 6-CHLORO-IMIDAZO[1,2-B]PYRIDAZIN-3-AMINE Chemical Properties |
| density | 1.71±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 4.89±0.30(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C6H5ClN4/c7-4-1-2-6-9-3-5(8)11(6)10-4/h1-3H,8H2 | | InChIKey | KZOZHHLJWBETLY-UHFFFAOYSA-N | | SMILES | C12=NC=C(N)N1N=C(Cl)C=C2 |
| | 6-CHLORO-IMIDAZO[1,2-B]PYRIDAZIN-3-AMINE Usage And Synthesis |
| | 6-CHLORO-IMIDAZO[1,2-B]PYRIDAZIN-3-AMINE Preparation Products And Raw materials |
|