| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
3-Iodophenylboronic acid pinacol ester manufacturers
|
| | 3-Iodophenylboronic acid pinacol ester Basic information |
| Product Name: | 3-Iodophenylboronic acid pinacol ester | | Synonyms: | 3-Iodobenzeneboronic acid pinacol ester, 97%;3-Iodophenylboronic acid pinacol ester;3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)iodobenzene;1,3,2-Dioxaborolane, 2-(3-iodophenyl)-4,4,5,5-tetramethyl-;3-Iodobenzeneboronicacidpinacolester,97%;2-(3-Iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | CAS: | 408492-28-4 | | MF: | C12H16BIO2 | | MW: | 329.97 | | EINECS: | | | Product Categories: | | | Mol File: | 408492-28-4.mol |  |
| | 3-Iodophenylboronic acid pinacol ester Chemical Properties |
| Melting point | 70-75 °C | | Boiling point | 356.4±25.0 °C(Predicted) | | density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | powder | | Appearance | White to off-white Solid | | Sensitive | Light Sensitive | | InChI | InChI=1S/C12H16BIO2/c1-11(2)12(3,4)16-13(15-11)9-6-5-7-10(14)8-9/h5-8H,1-4H3 | | InChIKey | HSHFNMSHDHAHDN-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C1=CC=CC(I)=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 |
| | 3-Iodophenylboronic acid pinacol ester Usage And Synthesis |
| Uses | 3-Iodophenylboronic acid, pinacol ester | | Synthesis | 2-(3-Iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, also known as 3-Iodophenylboronic acid pinacol ester, is synthesized by reacting Pinacol with 3-Iodophenylboronic acid.
|
| | 3-Iodophenylboronic acid pinacol ester Preparation Products And Raw materials |
|