| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Indoxyl sulfate potassium salt Basic information |
| | 3-Indoxyl sulfate potassium salt Chemical Properties |
| Melting point | 165 °C (dec.)(lit.) | | storage temp. | -20°C | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | color | light yellow | | Sensitive | Light Sensitive | | BRN | 3921324 | | Stability: | Hygroscopic | | InChI | 1S/C8H7NO4S.K/c10-14(11,12)13-8-5-9-7-4-2-1-3-6(7)8;/h1-5,9H,(H,10,11,12);/q;+1/p-1 | | InChIKey | MDAWATNFDJIBBD-UHFFFAOYSA-M | | SMILES | [K+].[O-]S(=O)(=O)Oc1c[nH]c2ccccc12 | | CAS DataBase Reference | 2642-37-7(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | NM3200000 | | F | 8-10-23 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | 3-Indoxyl sulfate potassium salt Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | An uremic toxin that acts as a potent endogenous agonist for the human aryl hydrocarbon receptor (AHR). Studies suggest that it is a sensitive and early biomarker of nephrotoxicity. |
| | 3-Indoxyl sulfate potassium salt Preparation Products And Raw materials |
|