|
|
| | 1-(4-Methoxyphenyl)piperazine hydrochloride Basic information |
| | 1-(4-Methoxyphenyl)piperazine hydrochloride Chemical Properties |
| Melting point | 42-47 °C(lit.) | | Fp | >230 °F | | storage temp. | Refrigerator | | solubility | DMSO, Methanol, Water | | form | Solid | | color | Off-White to Pale Pink | | InChI | InChI=1S/C11H16N2O.ClH/c1-14-11-4-2-10(3-5-11)13-8-6-12-7-9-13;/h2-5,12H,6-9H2,1H3;1H | | InChIKey | HFJDUYKRPHHPAX-UHFFFAOYSA-N | | SMILES | N1(C2=CC=C(OC)C=C2)CCNCC1.[H]Cl | | CAS DataBase Reference | 84145-43-7(CAS DataBase Reference) |
| | 1-(4-Methoxyphenyl)piperazine hydrochloride Usage And Synthesis |
| Uses | An intermediate in the synthesis of Itraconazole (I937500). |
| | 1-(4-Methoxyphenyl)piperazine hydrochloride Preparation Products And Raw materials |
|