|
|
| | 1-(3-Methoxyphenyl)piperazine dihydrochloride Basic information | | Uses |
| | 1-(3-Methoxyphenyl)piperazine dihydrochloride Chemical Properties |
| Melting point | 201-204 °C | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | color | White to gray or pinkish | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | BRN | 5647713 | | InChI | InChI=1S/C11H16N2O.ClH/c1-14-11-4-2-3-10(9-11)13-7-5-12-6-8-13;/h2-4,9,12H,5-8H2,1H3;1H | | InChIKey | QOQLPYRYJCBRNU-UHFFFAOYSA-N | | SMILES | O(C1=CC=CC(N2CCNCC2)=C1)C.Cl | | CAS DataBase Reference | 6968-76-9(CAS DataBase Reference) |
| | 1-(3-Methoxyphenyl)piperazine dihydrochloride Usage And Synthesis |
| Uses | 1-(3-Methoxyphenyl)piperazine dihydrochloride is a useful research chemical. | | Uses | 1-(3-Methoxyphenyl)piperazine dihydrochloride is used as an arylpiperazine compound which is an important intermediate in the preparation of various pharmaceuticals, used to treat depression and post-traumatic stress. |
| | 1-(3-Methoxyphenyl)piperazine dihydrochloride Preparation Products And Raw materials |
|