| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:N-Benzoyl-L-leucine
CAS:1466-83-7
Purity:>=99.0% Package:5G
|
BENZOYL-L-LEUCINE manufacturers
|
| | BENZOYL-L-LEUCINE Basic information |
| | BENZOYL-L-LEUCINE Chemical Properties |
| Melting point | 102-103 °C | | Boiling point | 458.8±28.0 °C(Predicted) | | density | 1.132±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | methanol: soluble50mg/mL, clear, colorless | | form | Solid | | pka | 3.82±0.10(Predicted) | | color | White to off-white | | Optical Rotation | [α]20/D 10.0±1°, c = 1% in methanol | | BRN | 2055078 | | Major Application | peptide synthesis | | InChI | 1S/C13H17NO3/c1-9(2)8-11(13(16)17)14-12(15)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3,(H,14,15)(H,16,17)/t11-/m0/s1 | | InChIKey | POLGZPYHEPOBFG-NSHDSACASA-N | | SMILES | CC(C)C[C@H](NC(=O)c1ccccc1)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | BENZOYL-L-LEUCINE Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: C-H Activation
reaction type: solution phase peptide synthesis
reagent type: ligand
reaction type: Peptide Synthesis |
| | BENZOYL-L-LEUCINE Preparation Products And Raw materials |
|