|
|
| | 2-(4-Boc-Piperazinyl)-2-phenylacetic acid Basic information |
| | 2-(4-Boc-Piperazinyl)-2-phenylacetic acid Chemical Properties |
| Melting point | 200-204 °C | | Boiling point | 436.2±45.0 °C(Predicted) | | density | 1.204±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 1.90±0.10(Predicted) | | form | solid | | color | White | | InChI | 1S/C17H24N2O4/c1-17(2,3)23-16(22)19-11-9-18(10-12-19)14(15(20)21)13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H,20,21) | | InChIKey | QPEHPIVVAWESTM-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(C(O)=O)c2ccccc2 | | CAS DataBase Reference | 347186-49-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 28-36/37 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| | 2-(4-Boc-Piperazinyl)-2-phenylacetic acid Usage And Synthesis |
| Definition | ChEBI: 2-(4-Boc-piperazino)-2-phenylacetic acid is an alpha-amino acid. |
| | 2-(4-Boc-Piperazinyl)-2-phenylacetic acid Preparation Products And Raw materials |
|