| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-Nitro-5-(phenylacetylamino)-benzoic acid Basic information |
| Product Name: | 2-Nitro-5-(phenylacetylamino)-benzoic acid | | Synonyms: | TIMTEC-BB SBB008308;6-NITRO-3-(PHENYLACETAMIDO)BENZOIC ACID;2-NITRO-5-(PHENYLACETYLAMINO)-BENZOIC ACID ---NIPAB, YELLOW CRYSTALLINE---;2-Nitro-5-(2-phenylacetamido)benzoic acid;2-nitro-5-[(2-phenylacetyl)amino]benzoic acid;2-Nitro-5-[(phenylacetyl)amino]benzoicAcid,98%;Benzoic acid, 2-nitro-5-[(2-phenylacetyl)amino]-;6-Nitro-3-(phenylacetamido)benzoic acid >=98% | | CAS: | 52033-70-2 | | MF: | C15H12N2O5 | | MW: | 300.27 | | EINECS: | | | Product Categories: | Activity;Chromogenic;Enzyme Substrates | | Mol File: | 52033-70-2.mol |  |
| | 2-Nitro-5-(phenylacetylamino)-benzoic acid Chemical Properties |
| Boiling point | 599.6±50.0 °C(Predicted) | | density | 1.446±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | ethanol: 9.80-10.20mg/mL, clear, faintly yellow to yellow | | pka | 2.05±0.25(Predicted) | | form | powder | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C15H12N2O5/c18-14(8-10-4-2-1-3-5-10)16-11-6-7-13(17(21)22)12(9-11)15(19)20/h1-7,9H,8H2,(H,16,18)(H,19,20) | | InChIKey | QHVQEQRGDKOHHC-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(NC(=O)Cc2ccccc2)ccc1[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 2-Nitro-5-(phenylacetylamino)-benzoic acid Usage And Synthesis |
| Description | 2-Nitro-5-(phenylacetylamino)-benzoic acid, also known as 6-Nitro-3-phenylacetamidobenzoic acid, is a chromogenic analogue of penicillin. | | Uses | 2-Nitro-5-(phenylacetylamino)-benzoic acid is used as a substrate for penicillin amidase, which produces phenylacetic acid and 5-amino-2-nitrobenzoic acid by PGA cleavage. Since 5-amino-2-nitro-benzoic acid is chromogenic, the substrate of 2-Nitro-5-(phenylacetylamino)-benzoic acid provides a convenient way to measure PGA activity.
 |
| | 2-Nitro-5-(phenylacetylamino)-benzoic acid Preparation Products And Raw materials |
|