| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Esprocarb
CAS:85785-20-2
Purity:100 μg/ML in MeOH Package:1ML
|
| Company Name: |
Sichuan Kulinan Technology Co., Ltd
|
| Tel: |
400-1166-196 18981987031 |
| Email: |
cdhxsj@163.com |
| Products Intro: |
Product Name:ESPROCARB
CAS:85785-20-2
Purity:99% HPLC Package:10g;50g;100g;500g;1kg;5kg;25kg
|
|
| | ESPROCARB Basic information |
| Product Name: | ESPROCARB | | Synonyms: | N-(1,2-Dimethylpropyl)-N-ethylcarbamothioic acid S-(phenylmethyl) ester;R 22957;esprocar (bsi, draft e-iso, draft f-iso);ESPROCARB STANDARD;(1,2-Dimethylpropyl)ethylcarbamothioic acid S-(phenylmethyl) ester;N-(1,2-Dimethylpropyl)-N-ethylthiocarbamic acid S-benzyl ester;Carbamothioic acid, (1,2-dimethylpropyl)ethyl-, S-(phenylmethyl) ester;Esprocarb [iso] | | CAS: | 85785-20-2 | | MF: | C15H23NOS | | MW: | 265.41 | | EINECS: | | | Product Categories: | | | Mol File: | 85785-20-2.mol |  |
| | ESPROCARB Chemical Properties |
| Melting point | <25℃ | | Boiling point | 135 °C | | density | 1.0566 (rough estimate) | | refractive index | 1.7500 (estimate) | | storage temp. | 0-6°C | | pka | -1.32±0.70(Predicted) | | Specific Gravity | 1.035 | | Henry's Law Constant | 1.8×101 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) | | Major Application | agriculture
environmental | | InChI | 1S/C15H23NOS/c1-5-16(13(4)12(2)3)15(17)18-11-14-9-7-6-8-10-14/h6-10,12-13H,5,11H2,1-4H3 | | InChIKey | BXEHUCNTIZGSOJ-UHFFFAOYSA-N | | SMILES | CCN(C(C)C(C)C)C(=O)SCc1ccccc1 | | EPA Substance Registry System | Esprocarb (85785-20-2) |
| Hazard Codes | N | | Risk Statements | 51/53 | | Safety Statements | 60 | | RIDADR | UN3082 9/PG 3 | | WGK Germany | 2 | | RTECS | FD3830000 | | HS Code | 29302000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2 |
| | ESPROCARB Usage And Synthesis |
| Uses | Esprocarb is used in the synergistic pesticidal compositions and methods for delivery of active ingredients. | | Definition | ChEBI: Esprocarb is a member of benzenes and a monothiocarbamic ester. |
| | ESPROCARB Preparation Products And Raw materials |
|