| Company Name: |
Shenzhen Huayi Brothers Technology Co.,Ltd |
| Tel: |
+8615914124590 |
| Email: |
ericzhang@szhybrother.com |
| Products Intro: |
Product Name:3-Ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)hexane;
3-Ethoxyperfluoro(2-methylhexane);
HFE 7500;
CAS:297730-93-9
Purity:0.99 Package:25KG
|
|
|
|
|
- FNM7500
-
- $0.00 / 1kg
-
2026-01-06
- CAS:297730-93-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 1ton
- 3-Ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)hexane;3-Ethoxyperfluoro(2-methylhexane);HFE 7500;
-
- $0.00 / 20kg
-
2025-10-14
- CAS:297730-93-9
- Min. Order: 20kg
- Purity: 99.99%
- Supply Ability: 200tons
|
| | 2-(Trifluoromethyl)-3-ethoxydodecafluorohexane Basic information |
| Product Name: | 2-(Trifluoromethyl)-3-ethoxydodecafluorohexane | | Synonyms: | Hexane, 3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-d odecafluoro-2-(trifluoromethyl)-;2-Trifluoromethyl-3-ethoxydodecafluorohexane(NOVEC 7500);2-(TRIFLUOROMETHYL)-3-ETHOXYDODECAFLUOROHEXANE;3-ETHOXYPERFLUORO(2-METHYLHEXANE);2-(Trifluoromethyl)-3-ethoxydodecafluorohexane 99%;2-(Trifluoromethyl)-3-ethoxydodecafluorohexane99%;Novec® 7500 Engineered Fluid;TIANFUCHEM--2-(TRIFLUOROMETHYL)-3-ETHOXYDODECAFLUOROHEXANE | | CAS: | 297730-93-9 | | MF: | C9H5F15O | | MW: | 414.11 | | EINECS: | 435-790-1 | | Product Categories: | | | Mol File: | 297730-93-9.mol |  |
| | 2-(Trifluoromethyl)-3-ethoxydodecafluorohexane Chemical Properties |
| Melting point | -100°C | | Boiling point | 130°C | | density | 1,61 g/cm3 | | vapor pressure | 8.466hPa at 20℃ | | storage temp. | Refrigerator, Under inert atmosphere | | solubility | Chloroform (Soluble), Methanol (Slightly) | | form | Oil | | color | Colourless | | Specific Gravity | 1.61 | | Henry's Law Constant | 1.9×10-8 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | Stability: | Volatile | | InChI | InChI=1S/C9H5F15O/c1-2-25-6(15,3(10,7(16,17)18)8(19,20)21)4(11,12)5(13,14)9(22,23)24/h2H2,1H3 | | InChIKey | HHBBIOLEJRWIGU-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(F)(C(F)(F)F)C(OCC)(F)C(F)(F)C(F)(F)C(F)(F)F | | LogP | 6 at 23℃ | | EPA Substance Registry System | Hexane, 3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)- (297730-93-9) |
| Hazard Codes | Xi | | Safety Statements | 23-24/25 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2909199050 |
| | 2-(Trifluoromethyl)-3-ethoxydodecafluorohexane Usage And Synthesis |
| Uses | 2-(Trifluoromethyl)-3-ethoxydodecafluorohexane can be used for temperature sensitive protein expression in protocells. It can also be used for light dispersion with enhanced thermal conductivity containing inorganic particles |
| | 2-(Trifluoromethyl)-3-ethoxydodecafluorohexane Preparation Products And Raw materials |
|