| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | S-Adenosyl-L-cysteine Basic information |
| | S-Adenosyl-L-cysteine Chemical Properties |
| Melting point | 217 °C (approx, decomp) | | Boiling point | 778.5±70.0 °C(Predicted) | | density | 2.00±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 2.08±0.10(Predicted) | | form | powder | | InChI | 1S/C13H18N6O5S/c14-5(13(22)23)1-25-2-6-8(20)9(21)12(24-6)19-4-18-7-10(15)16-3-17-11(7)19/h3-6,8-9,12,20-21H,1-2,14H2,(H,22,23)(H2,15,16,17) | | InChIKey | RVFHZLGRQFCOKV-UHFFFAOYSA-N | | SMILES | NC(CSCC1OC(C(O)C1O)n2cnc3c(N)ncnc23)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | S-Adenosyl-L-cysteine Usage And Synthesis |
| Uses | S-(5′-Adenosyl)-L-cysteine is a cysteine derivative[1]. | | Biochem/physiol Actions | S-adenosyl-L-cysteine, an analogue of S-adenosyl-L-homocysteine (L-AdoHcy), is used in the cyrstallizaton of methytransferases such as XMT and DXMT N-methyltransferases. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-807. DOI:10.1080/10408398.2012.708368 |
| | S-Adenosyl-L-cysteine Preparation Products And Raw materials |
|