|
|
| | TERT-BUTYL 3-AMINOBENZOATE Basic information | | Uses |
| | TERT-BUTYL 3-AMINOBENZOATE Chemical Properties |
| Melting point | 76-78 °C | | Boiling point | 309.2±15.0 °C(Predicted) | | density | 1.078±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder or crystals | | pka | 3.44±0.10(Predicted) | | color | white to light beige | | BRN | 2717992 | | Major Application | peptide synthesis | | InChI | 1S/C11H15NO2/c1-11(2,3)14-10(13)8-5-4-6-9(12)7-8/h4-7H,12H2,1-3H3 | | InChIKey | YGIRNXMYJLWFLH-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)c1cccc(N)c1 | | CAS DataBase Reference | 92146-82-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | TERT-BUTYL 3-AMINOBENZOATE Usage And Synthesis |
| Uses | tert-butyl 3-aminobenzoate is a useful research chemical. | | Uses | peptide synthesis | | Definition | ChEBI: Tert-butyl 3-aminobenzoate is a benzoate ester. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | TERT-BUTYL 3-AMINOBENZOATE Preparation Products And Raw materials |
|