- 4-Fluorobenzotrichloride
-
- $150.00 / 1ASSAYS
-
2023-06-26
- CAS:402-42-6
- Min. Order: 10g
- Purity: >99%
- Supply Ability: 500kg/month
|
| | 4-FLUOROBENZOTRICHLORIDE Basic information |
| Product Name: | 4-FLUOROBENZOTRICHLORIDE | | Synonyms: | 4-FLUOROBENZOTRICHLORIDE;4-Fluoro-alpha,,-trichlorotoluene;p-fluoro-alpha,alpha,alpha-trichlorotoluene;4-Fluorobenzotrichloride 99%;4-Fluorobenzotrichloride99%;p-Fluorbenzotrichlorid;p-Fluoro-α,α,α-trichlorotoluene;1-Fluoro-4-(trichloromethyl)benzene | | CAS: | 402-42-6 | | MF: | C7H4Cl3F | | MW: | 213.46 | | EINECS: | 206-942-0 | | Product Categories: | | | Mol File: | 402-42-6.mol |  |
| | 4-FLUOROBENZOTRICHLORIDE Chemical Properties |
| Boiling point | 76 C | | density | 1,425 g/cm | | refractive index | 1.534 | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | BRN | 2208417 | | InChI | InChI=1S/C7H4Cl3F/c8-7(9,10)5-1-3-6(11)4-2-5/h1-4H | | InChIKey | XOJYLEJZALFLLW-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(C(Cl)(Cl)Cl)C=C1 | | CAS DataBase Reference | 402-42-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 20/22-36/37/38 | | Safety Statements | 26-36/37/39-27 | | RIDADR | 2810 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2917399590 |
| Provider | Language |
|
ALFA
| English |
| | 4-FLUOROBENZOTRICHLORIDE Usage And Synthesis |
| | 4-FLUOROBENZOTRICHLORIDE Preparation Products And Raw materials |
|