- 2-FLUOROBENZOTRICHLORIDE
-
- $101.00 / 1KG
-
2023-12-29
- CAS:488-98-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-FLUOROBENZOTRICHLORIDE Basic information |
| Product Name: | 2-FLUOROBENZOTRICHLORIDE | | Synonyms: | o-fluoro-alpha,alpha,alpha-trichlorotoluene;2-fluoro-à,à,à-trichlorotoluene;2-Fluorobenzotrichloride 99%;2-Fluorobenzotrichloride99%;1-fluoro-2-(trichloromethyl)-benzene;1-(Trichloromethyl)-2-fluorobenzene;α,α,α-Trichloro-2-fluorotoluene;1-Fluoro-2-(trichloromethyl)benzene, 2-Fluoro-alpha,alpha,alpha-trichlorotoluene | | CAS: | 488-98-2 | | MF: | C7H4Cl3F | | MW: | 213.46 | | EINECS: | 207-692-5 | | Product Categories: | | | Mol File: | 488-98-2.mol |  |
| | 2-FLUOROBENZOTRICHLORIDE Chemical Properties |
| Melting point | -20 °C | | Boiling point | 75 °C5 mm Hg(lit.) | | density | 1.453 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.543(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Light yellow | | BRN | 2502576 | | InChI | InChI=1S/C7H4Cl3F/c8-7(9,10)5-3-1-2-4-6(5)11/h1-4H | | InChIKey | JYLVSNNSOWDQQX-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC=C1C(Cl)(Cl)Cl | | LogP | 3.58 | | CAS DataBase Reference | 488-98-2(CAS DataBase Reference) | | EPA Substance Registry System | 2-Fluorobenzotrichloride (488-98-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | RIDADR | 2810 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | Yes | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2903998090 |
| | 2-FLUOROBENZOTRICHLORIDE Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID |
| | 2-FLUOROBENZOTRICHLORIDE Preparation Products And Raw materials |
|