| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Bromo-L-phenylalanine Basic information |
| | 4-Bromo-L-phenylalanine Chemical Properties |
| Melting point | ~265 °C (dec.) | | Boiling point | 368.4±32.0 °C(Predicted) | | density | 1.588±0.06 g/cm3(Predicted) | | storage temp. | Store at RT. | | solubility | Methanol (Slightly, Sonicated), Water (Slightly, Heated, Sonicated) | | pka | 2.18±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D 22.0±2°, c = 0.5% in H2O | | BRN | 2212159 | | Stability: | Hygroscopic | | Major Application | peptide synthesis | | InChI | InChI=1S/C9H10BrNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 | | InChIKey | PEMUHKUIQHFMTH-QMMMGPOBSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(Br)C=C1)N | | CAS DataBase Reference | 24250-84-8(CAS DataBase Reference) |
| Hazard Codes | T,Xi | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2922498590 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 4-Bromo-L-phenylalanine Usage And Synthesis |
| Chemical Properties | Off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis | | Synthesis | A solution of compound (S)-acetyl-protected raw material (10 g, 0.048 mol) in 10% aqueous hydrochloric acid (100 mL) was stirred at 95-100 C for 6 h and then the pH was neutralized with triethylamine. The solid was collected by filtration and washed with water (40 mL) to afford the deacetylation product-like white solid L-4-bromophenylalanine. (Yield 68.4%) |
| | 4-Bromo-L-phenylalanine Preparation Products And Raw materials |
|