| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Naphthalene-2-boronic acid, pinacol ester Basic information |
| Product Name: | Naphthalene-2-boronic acid, pinacol ester | | Synonyms: | 2-Naphthaleneboronic acid, pinacol ester ,98%;4,4,5,5-Tetramethyl-2-(2-naphthyl)-1,3,2-dioxaborolane;2-(Naphth-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-Napthaleneboronic acid, pinacol ester;Naphthalene-2-boronic acid pinacol ester97%;1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-naphthalenyl)-;2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene;4,4,5,5-Tetramethyl-2-(2-naphthalenyl)-1,3,2-dioxaborolane | | CAS: | 256652-04-7 | | MF: | C16H19BO2 | | MW: | 254.13 | | EINECS: | | | Product Categories: | | | Mol File: | 256652-04-7.mol |  |
| | Naphthalene-2-boronic acid, pinacol ester Chemical Properties |
| Melting point | 64.0 to 68.0 °C | | Boiling point | 378.7±11.0 °C(Predicted) | | density | 1.06±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Solid | | color | White to Almost white | | Water Solubility | Slightly soluble in water. | | InChI | 1S/C16H19BO2/c1-15(2)16(3,4)19-17(18-15)14-10-9-12-7-5-6-8-13(12)11-14/h5-11H,1-4H3 | | InChIKey | SPPZBAGKKBHZRW-UHFFFAOYSA-N | | SMILES | CC1(C)C(C)(C)OB(O1)C2=CC=C3C(C=CC=C3)=C2 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Naphthalene-2-boronic acid, pinacol ester Usage And Synthesis |
| Chemical Properties | White solid | | Uses | It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs. |
| | Naphthalene-2-boronic acid, pinacol ester Preparation Products And Raw materials |
|