|
|
| | 1-Naphthylboronic acid Basic information |
| | 1-Naphthylboronic acid Chemical Properties |
| Melting point | 208-214 °C(lit.) | | Boiling point | 381.9±25.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | refractive index | n20D 1.64 (Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in DMSO, Methanol | | form | Powder | | pka | 8.53±0.30(Predicted) | | color | Off-white to pink beige | | Water Solubility | 2.5 g/100 mL | | BRN | 2937504 | | InChI | InChI=1S/C10H9BO2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,12-13H | | InChIKey | HUMMCEUVDBVXTQ-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC=C1B(O)O | | CAS DataBase Reference | 13922-41-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-Naphthylboronic acid Usage And Synthesis |
| Chemical Properties | Off-white to pink beige powder. soluble in methanol. Insoluble in water. | | Uses | 1-Naphthaleneboronic acid is a useful synthetic intermediate. It is a reagent used to synthesize potassium aryltrifluoroborates which is a convenient precursor of arylboron difluoride lewis acids. It is also useful in the synthesis of polyaromatic hydrocarbons utilizing the Suzuki reaction. | | Uses | Naphthalene-1-boronic acid can be used:
Methyl 5-bromo-2-(naphthalene-1-yl)benzoate, which is a starting material for the preparation of 9-anthracene-spirobenzofluorene host materials.
A bifunctional polymer used for the hydrolysis of cellulose.
9-(Naphthalene-1-yl)anthracene, which is a key intermediate for the preparation of anthracene derived molecular glass having blue emission.
1-Naphthaleneboronic acid can also be as a substrate in fluorometric boronic acid based saccharide sensors based on the Suzuki homocoupling reactions. | | Precautions | Incompatible with oxidizing agents. Store in a cool, dry condition in a well sealed container. Store at room temperature. |
| | 1-Naphthylboronic acid Preparation Products And Raw materials |
|