(S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid manufacturers
|
| | (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid Basic information |
| Product Name: | (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid | | Synonyms: | (S)-2-HYDROXY-3-(4-HYDROXY-PHENYL)-PROPIONIC ACID;(S)-3-(4'-HYDROXYPHENYL)-2-HYDROXY-PROPANOIC ACID;(S)-3-(4-HYDROXYPHENYL)LACTIC ACID;(2S)-2-HYDROXY-3-(4-HYDROXY-PHENYL)-PROPIONIC ACID;(2S)-3-(4-HYDROXYPHENYL)-2-HYDROXYPROPIONIC ACID;(S)-3-(4-Hysroxyphenyl)-2-hydroxypropionoicacid;Benzenepropanoic acid, .alpha.,4-dihydroxy-, (.alpha.S)-;(S)-2-hydroxy-3-(4-hydroxyphenyl)propanoic acid | | CAS: | 23508-35-2 | | MF: | C9H10O4 | | MW: | 182.17 | | EINECS: | | | Product Categories: | | | Mol File: | 23508-35-2.mol |  |
| | (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid Chemical Properties |
| Melting point | 165-168 °C | | Boiling point | 414.4±30.0 °C(Predicted) | | density | 1.404±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | pka | 3.80±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1/C9H10O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8,10-11H,5H2,(H,12,13)/t8-/s3 | | InChIKey | JVGVDSSUAVXRDY-SBYBRXNCNA-N | | SMILES | C(C1C=CC(O)=CC=1)[C@H](O)C(=O)O |&1:8,r| | | CAS DataBase Reference | 23508-35-2(CAS DataBase Reference) |
| | (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid Usage And Synthesis |
| Uses | (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid (compound 1) is a metabolite isolated from the culture medium of Leuconostoc mesenteroides. (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid has high DPPH radical-scavenging activities and antioxidative activities[1]. | | References | [1] Yu Geon Lee, et al. Isolation and antioxidative activity of amino acid derivatives produced by Leuconostoc mesenteroides. Food Sci Biotechnol. 2016 Feb 29;25(1):329-334. DOI:10.1007/s10068-016-0046-2 |
| | (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid Preparation Products And Raw materials |
|