| Company Name: |
Changzhou Huanling Chemical Co., Ltd.
|
| Tel: |
0519-89803565 13776850645 |
| Email: |
info4@huanlingchem.com |
| Products Intro: |
Product Name:2-HEXYLOCTANOIC ACID CAS:60948-91-6 Purity:98% Package:25KG;5KG;1KG
|
2-HEXYLOCTANOIC ACID manufacturers
- 2-HEXYLOCTANOIC ACID
-
- $2.00 / 1g
-
2020-03-06
- CAS:60948-91-6
- Min. Order: 1g
- Purity: 95~99.9%
- Supply Ability: 5KG
|
| | 2-HEXYLOCTANOIC ACID Basic information |
| Product Name: | 2-HEXYLOCTANOIC ACID | | Synonyms: | 2-hexyl-octanoicaci;2-HEXYLOCTANOIC ACID;Hexyloctanoic acid;2-BUTYL DECANOIC ACID;Ai3-11063;Einecs 262-534-2;Octanoic acid, 2-hexyl- | | CAS: | 60948-91-6 | | MF: | C14H28O2 | | MW: | 228.37 | | EINECS: | 262-534-2 | | Product Categories: | | | Mol File: | 60948-91-6.mol |  |
| | 2-HEXYLOCTANOIC ACID Chemical Properties |
| Boiling point | 159-160 °C(Press: 4 Torr) | | density | 0.8895 g/cm3 | | refractive index | 1.4421 (589.3 nm 20℃) | | storage temp. | Storage temp. 2-8°C | | pka | 4.90±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C14H28O2/c1-3-5-7-9-11-13(14(15)16)12-10-8-6-4-2/h13H,3-12H2,1-2H3,(H,15,16) | | InChIKey | SQPZLZZLAPHSPL-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(CCCCCC)CCCCCC | | LogP | 5.636 (est) | | EPA Substance Registry System | 2-Hexyloctanoic acid (60948-91-6) |
| | 2-HEXYLOCTANOIC ACID Usage And Synthesis |
| | 2-HEXYLOCTANOIC ACID Preparation Products And Raw materials |
|