6-chloro-3-iodopyridin-2-amine manufacturers
|
| | 6-chloro-3-iodopyridin-2-amine Basic information |
| Product Name: | 6-chloro-3-iodopyridin-2-amine | | Synonyms: | 6-chloro-3-iodopyridin-2-amine;6-Chloro-3-iodo-2-pyridinaMine;2-Pyridinamine, 6-chloro-3-iodo-;2-AMINO-6-CHLORO-3-IODOPYRIDINE;6-chloro-3-iodopyridin-2-amine ISO 9001:2015 REACH | | CAS: | 800402-06-6 | | MF: | C5H4ClIN2 | | MW: | 254.46 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 800402-06-6.mol |  |
| | 6-chloro-3-iodopyridin-2-amine Chemical Properties |
| Boiling point | 324.7±42.0 °C(Predicted) | | density | 2.139±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 0.40±0.50(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C5H4ClIN2/c6-4-2-1-3(7)5(8)9-4/h1-2H,(H2,8,9) | | InChIKey | GGXIOSCUHASSOL-UHFFFAOYSA-N | | SMILES | C1(N)=NC(Cl)=CC=C1I |
| | 6-chloro-3-iodopyridin-2-amine Usage And Synthesis |
| | 6-chloro-3-iodopyridin-2-amine Preparation Products And Raw materials |
|