| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
5-Hexenoic acid methyl ester manufacturers
- Methyl 5-Hexenoate
-
- $2.20
-
2026-08-25
- CAS:2396-80-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 50kg
|
| | 5-Hexenoic acid methyl ester Basic information |
| | 5-Hexenoic acid methyl ester Chemical Properties |
| Boiling point | 157 °C | | density | 0,91 g/cm3 | | refractive index | n20/D 1.421 | | Fp | 46°C | | storage temp. | Storage temp. 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C7H12O2/c1-3-4-5-6-7(8)9-2/h3H,1,4-6H2,2H3 | | InChIKey | ASKDFGVMJZMYEM-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCC=C | | LogP | 1.890 (est) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-10-22 | | Safety Statements | 26-36/37/39 | | RIDADR | UN3272 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2916199590 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Flam. Liq. 3 |
| | 5-Hexenoic acid methyl ester Usage And Synthesis |
| | 5-Hexenoic acid methyl ester Preparation Products And Raw materials |
|