|
|
| | 3-Methylcrotonoyl chloride Basic information |
| | 3-Methylcrotonoyl chloride Chemical Properties |
| Boiling point | 145-147 °C(lit.) | | density | 1.065 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.476(lit.) | | Fp | 124 °F | | storage temp. | 2-8°C | | solubility | soluble in Chloroform, Ethyl Acetate | | form | Liquid | | color | Clear colorless to yellow | | Water Solubility | reacts | | BRN | 1560268 | | InChI | InChI=1S/C5H7ClO/c1-4(2)3-5(6)7/h3H,1-2H3 | | InChIKey | BDUBTLFQHNYXPC-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)/C=C(\C)/C | | CAS DataBase Reference | 3350-78-5(CAS DataBase Reference) | | NIST Chemistry Reference | 3,3-Dimethylacryloyl chloride(3350-78-5) |
| Hazard Codes | C | | Risk Statements | 14-34-36/37-10 | | Safety Statements | 26-36/37/39-45-16 | | RIDADR | UN 2920 8/PG 2 | | WGK Germany | 3 | | F | 10-19 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29161900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1
Flam. Liq. 3
Skin Corr. 1B
STOT SE 3 |
| | 3-Methylcrotonoyl chloride Usage And Synthesis |
| Chemical Properties | clear colorless to yellow liquid | | Uses | 3,3-Dimethylacryloyl chloride was used in the synthesis of:
- substituted 4,4-dimethyl-3,4-dihydro-1H-quinolin-2-one via condensation with aniline
- N-(3,3-Dimethylacryloyl)-(S)-leucine methyl ester
| | General Description | 3,3-Dimethylacryloyl chloride reacts with silylketene acetals in acetonitrile to give δ-ethylenic β-keto esters. |
| | 3-Methylcrotonoyl chloride Preparation Products And Raw materials |
|