|
|
| | ANISYL PHENYLACETATE Basic information |
| Product Name: | ANISYL PHENYLACETATE | | Synonyms: | Acetic acid, phenyl-, p-methoxybenzyl ester;Benzeneaceticacid,(4-methoxyphenyl)methylester;p-Anisyl phenylacetate;phenyl-aceticacip-methoxybenzylester;p-Methoxybenzyl phenylacetate;p-methoxybenzylphenylacetate;PHENYLACETIC ACID P-METHOXYBENZYL ESTER;PARA ANISYL PHENYL ACETATE | | CAS: | 102-17-0 | | MF: | C16H16O3 | | MW: | 256.3 | | EINECS: | 203-010-5 | | Product Categories: | A-B;Alphabetical Listings;Flavors and Fragrances | | Mol File: | 102-17-0.mol |  |
| | ANISYL PHENYLACETATE Chemical Properties |
| Boiling point | 370 °C (lit.) | | density | 1.128 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.559 | | FEMA | 3740 | ANISYL PHENYLACETATE | | Fp | >230 °F | | solubility | organic solvents: soluble(lit.) | | Odor | at 100.00 %. anise honey balsam woody | | Odor Type | anisic | | biological source | synthetic | | Water Solubility | 512.6mg/L(25 ºC) | | JECFA Number | 876 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C16H16O3/c1-18-15-9-7-14(8-10-15)12-19-16(17)11-13-5-3-2-4-6-13/h2-10H,11-12H2,1H3 | | InChIKey | VCYWCSZLXMMLLE-UHFFFAOYSA-N | | SMILES | COc1ccc(COC(=O)Cc2ccccc2)cc1 | | LogP | 3.66 | | EPA Substance Registry System | Benzeneacetic acid, (4-methoxyphenyl)methyl ester (102-17-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | AJ3000000 | | TSCA | TSCA listed | | HS Code | 2916397700 | | Storage Class | 12 - Non Combustible Liquids | | Toxicity | LD50 orl-rat: >5 g/kg FCTXAV 18,651,80 |
| | ANISYL PHENYLACETATE Usage And Synthesis |
| Chemical Properties | Anisyl phenylacetate is a colorless oily liquid. Anisyl phenylacetate has an anise-, honey-like, faint, balsamic-rosy odor. | | Uses | Anisyl phenylacetate is used in flavor compositions mainly as a
modifier in Honey tlavors, and occasionally
as a fixative in flavors for baked goods, candy
and other "heat-treated" consumer products. Occasionally used in perfumes as a blenderfixative, giving considerable "background" or
"fond" in the composition. Concentrations are usually as low as 5.7 ppm. | | Definition | ChEBI: 4-Methoxybenzyl phenylacetate is a carboxylic ester. It is functionally related to a benzyl alcohol. | | Preparation | From anisyl alcohol and phenylacetic acid by direct esterification | | Safety Profile | Low toxicity by ingestion and skincontact. A skin irritant. When heated todecomposition it emits acrid smoke and irritating fumes. |
| | ANISYL PHENYLACETATE Preparation Products And Raw materials |
|